6-bromo-1-oxido-quinoline structure
|
Common Name | 6-bromo-1-oxido-quinoline | ||
|---|---|---|---|---|
| CAS Number | 6563-11-7 | Molecular Weight | 224.05400 | |
| Density | 1.58g/cm3 | Boiling Point | 358.3ºC at 760 mmHg | |
| Molecular Formula | C9H6BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 6-bromo-1-oxidoquinolin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 358.3ºC at 760 mmHg |
| Molecular Formula | C9H6BrNO |
| Molecular Weight | 224.05400 |
| Flash Point | 170.5ºC |
| Exact Mass | 222.96300 |
| PSA | 25.46000 |
| LogP | 3.03080 |
| Index of Refraction | 1.647 |
| InChIKey | PSZUKCUBGTVVPJ-UHFFFAOYSA-N |
| SMILES | [O-][n+]1cccc2cc(Br)ccc21 |
|
~%
6-bromo-1-oxido... CAS#:6563-11-7 |
| Literature: Wang, Danfeng; Liu, Rui; Chen, Chen; Wang, Shifan; Chang, Jin; Wu, Chunhui; Zhu, Hongjun; Waclawik, Eric R. Dyes and Pigments, 2013 , vol. 99, # 1 p. 240 - 249 |
| 6-Brom-chinolin-1-oxid |
| 6-bromo-1-oxido-quinoline |
| 6-bromoquinoline 1-oxide |
| 6-bromoquinoline N--oxide |