6α,19-epoxyandrost-4-ene-3,17-dione structure
|
Common Name | 6α,19-epoxyandrost-4-ene-3,17-dione | ||
|---|---|---|---|---|
| CAS Number | 6563-83-3 | Molecular Weight | 300.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6α,19-epoxyandrost-4-ene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24O3 |
|---|---|
| Molecular Weight | 300.39200 |
| Exact Mass | 300.17300 |
| PSA | 43.37000 |
| LogP | 3.07620 |
| InChIKey | ABDBICZRDFSYAS-ZEHJPDPISA-N |
| SMILES | CC12CCC3C(CC4OCC35CCC(=O)C=C45)C1CCC2=O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Inhibition of aromatase (unknown origin)
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3624595
|
|
Name: Competitive inhibition of human aromatase extracted from placental microsomes after 5...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3755859
|
| 6β,19-Epoxy-3,17-dioxo-Δ4-androsten |
| 6β,19-Epoxy-androst-4-en-3,17-dion |
| 6,19-Epoxy-3,17-dioxo-androst-4-en |