6α,19-epoxyandrost-4-ene-3,17-dione
6α,19-epoxyandrost-4-ene-3,17-dione structure
|
Common Name | 6α,19-epoxyandrost-4-ene-3,17-dione | ||
|---|---|---|---|---|
| CAS Number | 6563-83-3 | Molecular Weight | 300.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6α,19-epoxyandrost-4-ene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H24O3 |
|---|---|
| Molecular Weight | 300.39200 |
| Exact Mass | 300.17300 |
| PSA | 43.37000 |
| LogP | 3.07620 |
| InChIKey | ABDBICZRDFSYAS-ZEHJPDPISA-N |
| SMILES | CC12CCC3C(CC4OCC35CCC(=O)C=C45)C1CCC2=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:510-64-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of aromatase (unknown origin)
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3624595
|
|
Name: Competitive inhibition of human aromatase extracted from placental microsomes after 5...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3755859
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6β,19-Epoxy-3,17-dioxo-Δ4-androsten |
| 6β,19-Epoxy-androst-4-en-3,17-dion |
| 6,19-Epoxy-3,17-dioxo-androst-4-en |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: Molecular weight of 6α,19-epoxyandrost-4-ene-3,17-dione is 300.39200. |
| Q: What are the downstream products of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: Related downstream products(CAS) of 6α,19-epoxyandrost-4-ene-3,17-dione: 510-64-5. |
| Q: What is the polar surface area (PSA) of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: Polar surface area (PSA) of 6α,19-epoxyandrost-4-ene-3,17-dione is 43.37000. |
| Q: What is the Chinese name of 6563-83-3? |
| A: Chinese name of 6563-83-3 is 6563-83-3. |
| Q: What is the LogP of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: LogP of 6α,19-epoxyandrost-4-ene-3,17-dione is 3.07620. |
| Q: What is the InChIKey of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: InChIKey of 6α,19-epoxyandrost-4-ene-3,17-dione is ABDBICZRDFSYAS-ZEHJPDPISA-N. |
| Q: What is the SMILES notation of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: SMILES notation of 6α,19-epoxyandrost-4-ene-3,17-dione is CC12CCC3C(CC4OCC35CCC(=O)C=C45)C1CCC2=O. |
| Q: What is the molecular formula of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: Molecular formula of 6α,19-epoxyandrost-4-ene-3,17-dione is C19H24O3. |
| Q: What is the English name of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: The English name of 6α,19-epoxyandrost-4-ene-3,17-dione is 6α,19-epoxyandrost-4-ene-3,17-dione. |
| Q: What is the CAS number of 6α,19-epoxyandrost-4-ene-3,17-dione? |
| A: CAS number of 6α,19-epoxyandrost-4-ene-3,17-dione is 6563-83-3. |