Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]
Modify Date: 2025-08-29 21:06:28
![Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] Structure](https://www.chemsrc.com/extcaspic/249/65645-68-3.png)
Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] structure
|
Common Name | Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] | ||
|---|---|---|---|---|
| CAS Number | 65645-68-3 | Molecular Weight | 403.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17N3O4S2 |
|---|---|
| Molecular Weight | 403.5 |
| InChIKey | MBWAKUHTRRCKIY-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1S(=O)(=O)Nc1ccc(NS(=O)(=O)c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]? |
| A: The English name of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] is Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]. |
| Q: What is the InChIKey of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]? |
| A: InChIKey of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] is MBWAKUHTRRCKIY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]? |
| A: Molecular weight of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] is 403.5. |
| Q: What is the molecular formula of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]? |
| A: Molecular formula of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] is C18H17N3O4S2. |
| Q: What is the SMILES notation of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]? |
| A: SMILES notation of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] is Nc1ccccc1S(=O)(=O)Nc1ccc(NS(=O)(=O)c2ccccc2)cc1. |
| Q: What is the CAS number of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl]? |
| A: CAS number of Benzenesulfonamide,2-amino-n-[4-[(phenylsulfonyl)amino]phenyl] is 65645-68-3. |
| Q: What is the Chinese name of 65645-68-3? |
| A: Chinese name of 65645-68-3 is 65645-68-3. |