4-butyl-1,2-diphenylpyrazolidine-3,5-dione,5-(cyclohepten-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione,4-(dimethylamino)-1,5-dimethyl-2-phenylpyrazol-3-one structure
|
Common Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione,5-(cyclohepten-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione,4-(dimethylamino)-1,5-dimethyl-2-phenylpyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 65651-04-9 | Molecular Weight | 789.96100 | |
| Density | N/A | Boiling Point | 424.9ºC at 760 mmHg | |
| Molecular Formula | C45H55N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione,5-(cyclohepten-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione,4-(dimethylamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 424.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C45H55N7O6 |
| Molecular Weight | 789.96100 |
| Flash Point | 174.3ºC |
| Exact Mass | 789.42100 |
| PSA | 153.04000 |
| LogP | 7.65930 |
| InChIKey | FUFXHLDGPWRYIE-UHFFFAOYSA-N |
| SMILES | CCC1(C2=CCCCCC2)C(=O)NC(=O)NC1=O.CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.Cc1c(N(C)C)c(=O)n(-c2ccccc2)n1C |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(1-cyclohepten-1-yl)-5-ethyl-,mixt. with 4-butyl-1,2-diphenyl-3,5-pyrazolidinedione and 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |
| Phenylbutazone,aminopyrine combined with heptabarbital (3:7:7.5) |
| Baliomel |