N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide
![N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide Structure](https://image.chemsrc.com/caspic/032/65654-08-2.png)
N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide structure
|
Common Name | N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 65654-08-2 | Molecular Weight | 224.21300 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 91.15000 |
| LogP | 1.16160 |
| Index of Refraction | 1.562 |
| InChIKey | ZJTICILORBZVBV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NCC(=O)NO)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
N-[2-(hydroxyam... CAS#:65654-08-2 |
| Literature: Munakata; Tanaka; Toyoshima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 7 p. 2045 - 2051 |
|
~%
N-[2-(hydroxyam... CAS#:65654-08-2 |
| Literature: Munakata; Tanaka; Toyoshima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 7 p. 2045 - 2051 |
|
~%
N-[2-(hydroxyam... CAS#:65654-08-2 |
| Literature: Munakata; Tanaka; Toyoshima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 7 p. 2045 - 2051 |
![ETHYL 2-[(4-METHOXYBENZOYL)AMINO]ACETATE structure](https://image.chemsrc.com/caspic/400/51220-57-6.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Binding affinity towards (MMP-1) matrix metalloprotease-1
Source: ChEMBL
Target: Interstitial collagenase
External Id: CHEMBL872347
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(p-methoxybenzoyl)glycinohydroxamic acid |
| 2-(p-Methoxybenzamido)acetohydroxamic acid |
| ACETOHYDROXAMIC ACID,2-(p-METHOXYBENZAMIDO) |
| N-(HYDROXYCARBAMOYLMETHYL)-4-METHOXY-BENZAMIDE |
| 2-(para-Methoxybenzamid)-acetohydroxamsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: InChIKey of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is ZJTICILORBZVBV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: SMILES notation of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is COc1ccc(C(=O)NCC(=O)NO)cc1. |
| Q: What is the polar surface area (PSA) of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: Polar surface area (PSA) of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is 91.15000. |
| Q: What are the upstream materials of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: Related upstream materials(CAS) of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide: 51220-57-6;100-07-2;100-09-4. |
| Q: What is the English name of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: The English name of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide. |
| Q: What is the molecular formula of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: Molecular formula of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is C10H12N2O4. |
| Q: What is the LogP of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: LogP of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is 1.16160. |
| Q: What is the Chinese name of 65654-08-2? |
| A: Chinese name of 65654-08-2 is 65654-08-2. |
| Q: What English synonyms does N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide have? |
| A: English synonyms of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide: N-(p-methoxybenzoyl)glycinohydroxamic acid, 2-(p-Methoxybenzamido)acetohydroxamic acid, ACETOHYDROXAMIC ACID,2-(p-METHOXYBENZAMIDO), N-(HYDROXYCARBAMOYLMETHYL)-4-METHOXY-BENZAMIDE, 2-(para-Methoxybenzamid)-acetohydroxamsaeure. |
| Q: What is the molecular weight of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide? |
| A: Molecular weight of N-[2-(hydroxyamino)-2-oxoethyl]-4-methoxybenzamide is 224.21300. |