2-methoxyhippurohydroxamic acid structure
|
Common Name | 2-methoxyhippurohydroxamic acid | ||
|---|---|---|---|---|
| CAS Number | 65654-09-3 | Molecular Weight | 224.21300 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(hydroxyamino)-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 94.64000 |
| LogP | 1.34550 |
| Index of Refraction | 1.562 |
| InChIKey | DCHIOYOYIFRQNA-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)NCC(=O)NO)c1 |
|
~%
2-methoxyhippur... CAS#:65654-09-3 |
| Literature: Munakata; Tanaka; Toyoshima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 7 p. 2045 - 2051 |
|
~%
2-methoxyhippur... CAS#:65654-09-3 |
| Literature: Munakata; Tanaka; Toyoshima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 7 p. 2045 - 2051 |
|
~%
2-methoxyhippur... CAS#:65654-09-3 |
| Literature: Munakata; Tanaka; Toyoshima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 7 p. 2045 - 2051 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(m-Methoxybenzamido)acetohydroxamic acid |
| Benzamide,N-(2-(hydroxyamino)-2-oxoethyl)-3-methoxy |
| 2-Methoxyhippurohydroxamic acid |
| 2-(meta-Methoxybenzamid)-acetohydroxamsaeure |
| ACETOHYDROXAMIC ACID,2-(m-METHOXYBENZAMIDO) |