ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate
ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate structure
|
Common Name | ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 65659-40-7 | Molecular Weight | 308.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H28O4 |
|---|---|
| Molecular Weight | 308.41300 |
| Exact Mass | 308.19900 |
| PSA | 55.76000 |
| LogP | 3.92910 |
| InChIKey | RDQPSRYLSQXXJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 2-(3,5-di... CAS#:65659-40-7 |
| Literature: Gardner,J.O.; Beard,C.C. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 357 - 361 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetic acid,[3,5-bis(1,1-dimethylethyl)-2-hydroxyphenoxy]-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: CAS number of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is 65659-40-7. |
| Q: What is the molecular weight of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: Molecular weight of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is 308.41300. |
| Q: What is the molecular formula of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: Molecular formula of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is C18H28O4. |
| Q: What are the upstream materials of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: Related upstream materials(CAS) of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate: 1020-31-1;105-36-2. |
| Q: What is the SMILES notation of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: SMILES notation of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is CCOC(=O)COc1cc(C(C)(C)C)cc(C(C)(C)C)c1O. |
| Q: What is the InChIKey of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: InChIKey of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is RDQPSRYLSQXXJZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 65659-40-7? |
| A: Chinese name of 65659-40-7 is 65659-40-7. |
| Q: What is the LogP of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: LogP of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is 3.92910. |
| Q: What is the English name of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate? |
| A: The English name of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate is ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate. |
| Q: What English synonyms does ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate have? |
| A: English synonyms of ethyl 2-(3,5-ditert-butyl-2-hydroxyphenoxy)acetate: Acetic acid,[3,5-bis(1,1-dimethylethyl)-2-hydroxyphenoxy]-,ethyl ester. |