Anhydrocannabisativine
Modify Date: 2026-07-04 08:10:19
Anhydrocannabisativine structure
|
Common Name | Anhydrocannabisativine | ||
|---|---|---|---|---|
| CAS Number | 65664-79-1 | Molecular Weight | 363.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H37N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Anhydrocannabisativine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H37N3O2 |
|---|---|
| Molecular Weight | 363.5 |
| InChIKey | RKTWGMYTKBSCLV-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)CC1C=CCC2CC(=O)NCCCCNCCCN12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Anhydrocannabisativine? |
| A: Molecular weight of Anhydrocannabisativine is 363.5. |
| Q: What is the molecular formula of Anhydrocannabisativine? |
| A: Molecular formula of Anhydrocannabisativine is C21H37N3O2. |
| Q: What is the InChIKey of Anhydrocannabisativine? |
| A: InChIKey of Anhydrocannabisativine is RKTWGMYTKBSCLV-UHFFFAOYSA-N. |
| Q: What is the CAS number of Anhydrocannabisativine? |
| A: CAS number of Anhydrocannabisativine is 65664-79-1. |
| Q: What is the Chinese name of 65664-79-1? |
| A: Chinese name of 65664-79-1 is 65664-79-1. |
| Q: What is the English name of Anhydrocannabisativine? |
| A: The English name of Anhydrocannabisativine is Anhydrocannabisativine. |
| Q: What is the SMILES notation of Anhydrocannabisativine? |
| A: SMILES notation of Anhydrocannabisativine is CCCCCC(=O)CC1C=CCC2CC(=O)NCCCCNCCCN12. |