6-Chloro-4-hydroxy-3-iodo-2-methylquinoline
Modify Date: 2026-04-30 19:21:20
6-Chloro-4-hydroxy-3-iodo-2-methylquinoline structure
|
Common Name | 6-Chloro-4-hydroxy-3-iodo-2-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 65673-92-9 | Molecular Weight | 319.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClINO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Chloro-4-hydroxy-3-iodo-2-methylquinoline |
|---|
| Molecular Formula | C10H7ClINO |
|---|---|
| Molecular Weight | 319.52 |
| InChIKey | JUXWCUNUJNDZMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(N1)C=CC(=C2)Cl)I |
|
Name: NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL1040691
|
|
Name: NOVARTIS: Inhibition Frequency Index (IFI) - the number of HTS assays where a compoun...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1040694
|
|
Name: NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in er...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL1040692
|
|
Name: NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7)
Source: ChEMBL
Target: Huh-7
External Id: CHEMBL1040693
|
Total 4, Current Page 1 of 1
1