3-(2,2-dimethyl-5-oxocyclopentyl)-2H-furan-5-one structure
|
Common Name | 3-(2,2-dimethyl-5-oxocyclopentyl)-2H-furan-5-one | ||
|---|---|---|---|---|
| CAS Number | 65688-83-7 | Molecular Weight | 194.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,2-dimethyl-5-oxocyclopentyl)-2H-furan-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14O3 |
|---|---|
| Molecular Weight | 194.22700 |
| Exact Mass | 194.09400 |
| PSA | 43.37000 |
| LogP | 1.47490 |
| InChIKey | ZFBKAPZLPRRSLG-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(=O)C1C1=CC(=O)OC1 |
|
~%
3-(2,2-dimethyl... CAS#:65688-83-7 |
| Literature: Kosugi, Hiroshi; Uda, Hisashi Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 1 p. 160 - 168 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-(2,2-dimethyl-5-oxocyclopentyl)-2(5H)-furanone |
| 2(5H)-Furanone,4-(2,2-dimethyl-5-oxocyclopentyl) |