2-ethylthio-4-hydroxy-6-trifluoromethylpyrimidine structure
|
Common Name | 2-ethylthio-4-hydroxy-6-trifluoromethylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 657-58-9 | Molecular Weight | 224.20300 | |
| Density | 1.48 | Boiling Point | 226ºC | |
| Molecular Formula | C7H7F3N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90ºC | |
| Name | 2-ethylsulfanyl-6-(trifluoromethyl)-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48 |
|---|---|
| Boiling Point | 226ºC |
| Molecular Formula | C7H7F3N2OS |
| Molecular Weight | 224.20300 |
| Flash Point | 90ºC |
| Exact Mass | 224.02300 |
| PSA | 71.31000 |
| LogP | 2.31300 |
| Index of Refraction | 1.533 |
| InChIKey | SGRGYWVPMIRUTA-UHFFFAOYSA-N |
| SMILES | CCSc1nc(C(F)(F)F)cc(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~%
2-ethylthio-4-h... CAS#:657-58-9 |
| Literature: Journal of the Chemical Society, , p. 3278,3282 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Aethylmercapto-6-trifluormethyl-3H-pyrimidin-4-on |
| 2-Ethylthio-4-hydroxy-6-trifluoromethylpyrimidine |
| 2-ethylmercapto-6-trifluoromethyl-3H-pyrimidin-4-one |