para-(chlorodifluoromethyl)benzene isocyanate
Modify Date: 2026-07-16 18:43:55
para-(chlorodifluoromethyl)benzene isocyanate structure
|
Common Name | para-(chlorodifluoromethyl)benzene isocyanate | ||
|---|---|---|---|---|
| CAS Number | 657-93-2 | Molecular Weight | 203.57300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4ClF2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | para-(chlorodifluoromethyl)benzene isocyanate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4ClF2NO |
|---|---|
| Molecular Weight | 203.57300 |
| Exact Mass | 202.99500 |
| PSA | 29.43000 |
| LogP | 2.94200 |
| InChIKey | CYDVTVDSOYJCRM-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccc(C(F)(F)Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 657-93-2? |
| A: Chinese name of 657-93-2 is 657-93-2. |
| Q: What is the molecular weight of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: Molecular weight of para-(chlorodifluoromethyl)benzene isocyanate is 203.57300. |
| Q: What is the polar surface area (PSA) of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: Polar surface area (PSA) of para-(chlorodifluoromethyl)benzene isocyanate is 29.43000. |
| Q: What is the InChIKey of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: InChIKey of para-(chlorodifluoromethyl)benzene isocyanate is CYDVTVDSOYJCRM-UHFFFAOYSA-N. |
| Q: What is the LogP of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: LogP of para-(chlorodifluoromethyl)benzene isocyanate is 2.94200. |
| Q: What is the CAS number of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: CAS number of para-(chlorodifluoromethyl)benzene isocyanate is 657-93-2. |
| Q: What is the English name of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: The English name of para-(chlorodifluoromethyl)benzene isocyanate is para-(chlorodifluoromethyl)benzene isocyanate. |
| Q: What is the molecular formula of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: Molecular formula of para-(chlorodifluoromethyl)benzene isocyanate is C8H4ClF2NO. |
| Q: What is the SMILES notation of para-(chlorodifluoromethyl)benzene isocyanate? |
| A: SMILES notation of para-(chlorodifluoromethyl)benzene isocyanate is O=C=Nc1ccc(C(F)(F)Cl)cc1. |