Isoquinoline,1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6,7-dimethoxy-2-propyl- structure
|
Common Name | Isoquinoline,1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6,7-dimethoxy-2-propyl- | ||
|---|---|---|---|---|
| CAS Number | 65700-38-1 | Molecular Weight | 385.49700 | |
| Density | 1.083g/cm3 | Boiling Point | 492.4ºC at 760mmHg | |
| Molecular Formula | C23H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.5ºC | |
| Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-propyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 492.4ºC at 760mmHg |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.49700 |
| Flash Point | 134.5ºC |
| Exact Mass | 385.22500 |
| PSA | 40.16000 |
| LogP | 4.21080 |
| Index of Refraction | 1.541 |
| InChIKey | HXVWWPSVYMTSQW-UHFFFAOYSA-N |
| SMILES | CCCN1CCc2cc(OC)c(OC)cc2C1Cc1ccc(OC)c(OC)c1 |
|
~%
Isoquinoline,1-... CAS#:65700-38-1 |
| Literature: Anastasia; Cighetti; Allevi Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 19 p. 2398 - 2403 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6,7-dimethoxy-2-propyl-1-veratryl-1,2,3,4-tetrahydro-isoquinoline |
| 6,7-Dimethoxy-2-propyl-1-veratryl-1,2,3,4-tetrahydro-isochinolin |
| N-Propyl-1,2,3,4-tetrahydropapaverin |
| N-Propyl-tetrahydro-papaverin |