1-methyl-4-prop-1-en-2-ylcyclohexene,phenol,4,6,6-trimethylbicyclo[3.1.1]hept-3-ene structure
|
Common Name | 1-methyl-4-prop-1-en-2-ylcyclohexene,phenol,4,6,6-trimethylbicyclo[3.1.1]hept-3-ene | ||
|---|---|---|---|---|
| CAS Number | 65733-79-1 | Molecular Weight | 366.57900 | |
| Density | N/A | Boiling Point | 175.4ºC at 760 mmHg | |
| Molecular Formula | C26H38O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 42.8ºC | |
| Name | 1-methyl-4-prop-1-en-2-ylcyclohexene,phenol,4,6,6-trimethylbicyclo[3.1.1]hept-3-ene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 175.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H38O |
| Molecular Weight | 366.57900 |
| Flash Point | 42.8ºC |
| Exact Mass | 366.29200 |
| PSA | 20.23000 |
| LogP | 7.69980 |
| InChIKey | NRJBYVAUTDMSIA-UHFFFAOYSA-N |
| SMILES | C=C(C)C1CC=C(C)CC1.CC1=CCC2CC1C2(C)C.Oc1ccccc1 |
| Phenol,polymer with 2,6,6-trimethylbicyclo(3.1.1)hept-2-ene and 1-methyl-4-(1-methylethenyl)cyclohexene |
| Phenol,polymer with 1-methyl-4-(1-methylethenyl)cyclohexene and 2,6,6-trimethylbicyclo(3.1.1)hept-2-ene |