2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl
Modify Date: 2025-09-10 18:35:07
2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl structure
|
Common Name | 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 65735-59-3 | Molecular Weight | 494.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18Br2N6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18Br2N6S2 |
|---|---|
| Molecular Weight | 494.3 |
| InChIKey | NTHCZCHQKNFVEG-UHFFFAOYSA-N |
| SMILES | Cc1nc(N(C)C)nc(SSc2nc(N(C)C)nc(C)c2Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl? |
| A: CAS number of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl is 65735-59-3. |
| Q: What is the SMILES notation of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl? |
| A: SMILES notation of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl is Cc1nc(N(C)C)nc(SSc2nc(N(C)C)nc(C)c2Br)c1Br. |
| Q: What is the English name of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl? |
| A: The English name of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl is 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl. |
| Q: What is the InChIKey of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl? |
| A: InChIKey of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl is NTHCZCHQKNFVEG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl? |
| A: Molecular formula of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl is C14H18Br2N6S2. |
| Q: What is the Chinese name of 65735-59-3? |
| A: Chinese name of 65735-59-3 is 65735-59-3. |
| Q: What is the molecular weight of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl? |
| A: Molecular weight of 2-Pyrimidinamine, 4,4a(2)-dithiobis[5-bromo-N,N,6-trimethyl is 494.3. |