3,4-dichlorophenylguanidinium nitrate structure
|
Common Name | 3,4-dichlorophenylguanidinium nitrate | ||
|---|---|---|---|---|
| CAS Number | 65783-11-1 | Molecular Weight | 267.06900 | |
| Density | N/A | Boiling Point | 296.1ºC at 760 mmHg | |
| Molecular Formula | C7H8Cl2N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.9ºC | |
| Name | carbamimidoyl-(3,4-dichlorophenyl)azanium,nitrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 296.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H8Cl2N4O3 |
| Molecular Weight | 267.06900 |
| Flash Point | 132.9ºC |
| Exact Mass | 265.99700 |
| PSA | 132.52000 |
| LogP | 1.53650 |
| InChIKey | JERGTFYMPGRDBN-UHFFFAOYSA-O |
| SMILES | N=C(N)[NH2+]c1ccc(Cl)c(Cl)c1.O=[N+]([O-])[O-] |
|
~81%
3,4-dichlorophe... CAS#:65783-11-1 |
| Literature: Werbel, Leslie M.; Elslager, Edward F.; Hess, Carolyn; Hutt, Marland P. Journal of Medicinal Chemistry, 1987 , vol. 30, # 11 p. 1943 - 1948 |
|
~%
3,4-dichlorophe... CAS#:65783-11-1 |
| Literature: Tavares, Francis X.; Boucheron, Joyce A.; Dickerson, Scott H.; Griffin, Robert J.; Preugschat, Frank; Thomso, Stephen A.; Wang, Tony Y.; Zhouf, Hui-Qiang Journal of Medicinal Chemistry, 2004 , vol. 47, # 19 p. 4716 - 4730 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| EINECS 265-926-1 |
| N-(3,4-dichlorophenyl)guanidine nitrate |
| 3,4-Dichlorophenylguanidinium nitrate |
| carbamimidoyl-(3,4-dichlorophenyl)azanium nitrate |