3-(Trifluoromethoxy)benzoyl fluoride structure
|
Common Name | 3-(Trifluoromethoxy)benzoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 658-90-2 | Molecular Weight | 208.11000 | |
| Density | 1.384g/cm3 | Boiling Point | 175ºC at 760 mmHg | |
| Molecular Formula | C8H4F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 58.5ºC | |
| Name | 3-(Trifluoromethoxy)benzoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 175ºC at 760 mmHg |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11000 |
| Flash Point | 58.5ºC |
| Exact Mass | 208.01500 |
| PSA | 26.30000 |
| LogP | 2.69490 |
| Index of Refraction | 1.431 |
| InChIKey | XRRBDBIQJMJLJV-UHFFFAOYSA-N |
| SMILES | O=C(F)c1cccc(OC(F)(F)F)c1 |
|
~%
3-(Trifluoromet... CAS#:658-90-2 |
| Literature: Stogryn Journal of Medicinal Chemistry, 1973 , vol. 16, # 12 p. 1399 - 1401 |
| EINECS 211-526-7 |
| 3-Trifluormethoxy-benzoesaeure-fluorid |