3-(Trifluoromethoxy)benzoyl fluoride
3-(Trifluoromethoxy)benzoyl fluoride structure
|
Common Name | 3-(Trifluoromethoxy)benzoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 658-90-2 | Molecular Weight | 208.11000 | |
| Density | 1.384g/cm3 | Boiling Point | 175ºC at 760 mmHg | |
| Molecular Formula | C8H4F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 58.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Trifluoromethoxy)benzoyl fluoride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 175ºC at 760 mmHg |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11000 |
| Flash Point | 58.5ºC |
| Exact Mass | 208.01500 |
| PSA | 26.30000 |
| LogP | 2.69490 |
| Index of Refraction | 1.431 |
| InChIKey | XRRBDBIQJMJLJV-UHFFFAOYSA-N |
| SMILES | O=C(F)c1cccc(OC(F)(F)F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(Trifluoromet... CAS#:658-90-2 |
| Literature: Stogryn Journal of Medicinal Chemistry, 1973 , vol. 16, # 12 p. 1399 - 1401 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 211-526-7 |
| 3-Trifluormethoxy-benzoesaeure-fluorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: Molecular formula of 3-(Trifluoromethoxy)benzoyl fluoride is C8H4F4O2. |
| Q: What is the polar surface area (PSA) of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: Polar surface area (PSA) of 3-(Trifluoromethoxy)benzoyl fluoride is 26.30000. |
| Q: What is the CAS number of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: CAS number of 3-(Trifluoromethoxy)benzoyl fluoride is 658-90-2. |
| Q: What is the boiling point of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: Boiling point of 3-(Trifluoromethoxy)benzoyl fluoride is 175ºC at 760 mmHg. |
| Q: What is the InChIKey of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: InChIKey of 3-(Trifluoromethoxy)benzoyl fluoride is XRRBDBIQJMJLJV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: SMILES notation of 3-(Trifluoromethoxy)benzoyl fluoride is O=C(F)c1cccc(OC(F)(F)F)c1. |
| Q: What is the molecular weight of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: Molecular weight of 3-(Trifluoromethoxy)benzoyl fluoride is 208.11000. |
| Q: What is the English name of 3-(Trifluoromethoxy)benzoyl fluoride? |
| A: The English name of 3-(Trifluoromethoxy)benzoyl fluoride is 3-(Trifluoromethoxy)benzoyl fluoride. |
| Q: What is the Chinese name of 658-90-2? |
| A: Chinese name of 658-90-2 is 658-90-2. |
| Q: What English synonyms does 3-(Trifluoromethoxy)benzoyl fluoride have? |
| A: English synonyms of 3-(Trifluoromethoxy)benzoyl fluoride: EINECS 211-526-7, 3-Trifluormethoxy-benzoesaeure-fluorid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |