triphenyl(propan-2-yloxy)stannane
triphenyl(propan-2-yloxy)stannane structure
|
Common Name | triphenyl(propan-2-yloxy)stannane | ||
|---|---|---|---|---|
| CAS Number | 65809-33-8 | Molecular Weight | 409.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22OSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | triphenyl(propan-2-yloxy)stannane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H22OSn |
|---|---|
| Molecular Weight | 409.10000 |
| Exact Mass | 410.06900 |
| PSA | 23.06000 |
| LogP | 4.90490 |
| InChIKey | AIJVXRKCEHXSTH-UHFFFAOYSA-N |
| SMILES | CC(C)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
triphenyl(propa... CAS#:65809-33-8 |
| Literature: Chisholm, Malcolm H.; Delbridge, Ewan E. New Journal of Chemistry, 2003 , vol. 27, # 8 p. 1167 - 1176 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Stannane,(1-methylethoxy)triphenyl |
| triphenyltin(IV) isopropoxide |
| iso-propoxyxytriphenyltin(IV) |
| triphenyltin isopropoxide |
| Ph3SnOPr(i) |
| isopropoxytriphenyltin(IV) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of triphenyl(propan-2-yloxy)stannane? |
| A: InChIKey of triphenyl(propan-2-yloxy)stannane is AIJVXRKCEHXSTH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of triphenyl(propan-2-yloxy)stannane? |
| A: Molecular formula of triphenyl(propan-2-yloxy)stannane is C21H22OSn. |
| Q: What is the LogP of triphenyl(propan-2-yloxy)stannane? |
| A: LogP of triphenyl(propan-2-yloxy)stannane is 4.90490. |
| Q: What is the polar surface area (PSA) of triphenyl(propan-2-yloxy)stannane? |
| A: Polar surface area (PSA) of triphenyl(propan-2-yloxy)stannane is 23.06000. |
| Q: What are the upstream materials of triphenyl(propan-2-yloxy)stannane? |
| A: Related upstream materials(CAS) of triphenyl(propan-2-yloxy)stannane: 1092-86-0;67-63-0. |
| Q: What English synonyms does triphenyl(propan-2-yloxy)stannane have? |
| A: English synonyms of triphenyl(propan-2-yloxy)stannane: Stannane,(1-methylethoxy)triphenyl, triphenyltin(IV) isopropoxide, iso-propoxyxytriphenyltin(IV), triphenyltin isopropoxide, Ph3SnOPr(i), isopropoxytriphenyltin(IV). |
| Q: What is the SMILES notation of triphenyl(propan-2-yloxy)stannane? |
| A: SMILES notation of triphenyl(propan-2-yloxy)stannane is CC(C)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the Chinese name of 65809-33-8? |
| A: Chinese name of 65809-33-8 is 65809-33-8. |
| Q: What is the English name of triphenyl(propan-2-yloxy)stannane? |
| A: The English name of triphenyl(propan-2-yloxy)stannane is triphenyl(propan-2-yloxy)stannane. |
| Q: What is the CAS number of triphenyl(propan-2-yloxy)stannane? |
| A: CAS number of triphenyl(propan-2-yloxy)stannane is 65809-33-8. |