1,2,3,4,5,6,7,8,9-nonamethyl-10-methylidene-9H-anthracene structure
|
Common Name | 1,2,3,4,5,6,7,8,9-nonamethyl-10-methylidene-9H-anthracene | ||
|---|---|---|---|---|
| CAS Number | 65819-05-8 | Molecular Weight | 318.49500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5,6,7,8,9-nonamethyl-10-methylidene-9H-anthracene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H30 |
|---|---|
| Molecular Weight | 318.49500 |
| Exact Mass | 318.23500 |
| LogP | 6.68050 |
| InChIKey | FMOVOMAEXGAHQE-UHFFFAOYSA-N |
| SMILES | C=C1c2c(C)c(C)c(C)c(C)c2C(C)c2c(C)c(C)c(C)c(C)c21 |
|
~%
1,2,3,4,5,6,7,8... CAS#:65819-05-8 |
| Literature: Hart, Harold; Lai, Chung-yin; Nwokogu, Godson Chukuemaka; Shamouilian, Shamouil Tetrahedron, 1987 , vol. 43, # 22 p. 5203 - 5224 |
|
~11%
1,2,3,4,5,6,7,8... CAS#:65819-05-8 |
| Literature: Hart, Harold; Lai, Chung-yin; Nwokogu, Godson; Shamouilian, Shamouil; Teuerstein, Avraham; Zlotogorski, Chana Journal of the American Chemical Society, 1980 , vol. 102, # 21 p. 6649 - 6651 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Anthracene,9,10-dihydro-1,2,3,4,5,6,7,8,9-nonamethyl-10-methylene |
| 1,2,3,4,5,6,7,8,10-nonamethyl-9-methylene-9,10-dihydroanthracene |