1,4-bis(chloromethyl)-2,5-dipropoxybenzene structure
|
Common Name | 1,4-bis(chloromethyl)-2,5-dipropoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 65823-50-9 | Molecular Weight | 291.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis(chloromethyl)-2,5-dipropoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20Cl2O2 |
|---|---|
| Molecular Weight | 291.21300 |
| Exact Mass | 290.08400 |
| PSA | 18.46000 |
| LogP | 4.74180 |
| InChIKey | MJRGBFSEENNGFO-UHFFFAOYSA-N |
| SMILES | CCCOc1cc(CCl)c(OCCC)cc1CCl |
|
~%
1,4-bis(chlorom... CAS#:65823-50-9 |
| Literature: Stalmach, Ulf; Kolshorn, Heinz; Brehm, Isabella; Meier, Herbert Liebigs Annales, 1996 , # 9 p. 1449 - 1456 |
|
~%
1,4-bis(chlorom... CAS#:65823-50-9 |
| Literature: Sakamoto,K.; Oki,M. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 3388 - 3392 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzene,1,4-bis(chloromethyl)-2,5-dipropoxy |
| 1,4-Bis-chlormethyl-2,5-dipropoxy-benzol |
| 1,4-bis-chloromethyl-2,5-dipropoxy-benzene |