N,N-bis(2-bromopropyl)-9H-fluoren-2-amine structure
|
Common Name | N,N-bis(2-bromopropyl)-9H-fluoren-2-amine | ||
|---|---|---|---|---|
| CAS Number | 6583-81-9 | Molecular Weight | 423.18500 | |
| Density | 1.514g/cm3 | Boiling Point | 501.7ºC at 760 mmHg | |
| Molecular Formula | C19H21Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.2ºC | |
| Name | N,N-bis(2-bromopropyl)-9H-fluoren-2-amine |
|---|
| Density | 1.514g/cm3 |
|---|---|
| Boiling Point | 501.7ºC at 760 mmHg |
| Molecular Formula | C19H21Br2N |
| Molecular Weight | 423.18500 |
| Flash Point | 257.2ºC |
| Exact Mass | 421.00400 |
| PSA | 3.24000 |
| LogP | 5.63100 |
| Index of Refraction | 1.65 |
| InChIKey | KXXFPDNKSPNSMV-UHFFFAOYSA-N |
| SMILES | CC(Br)CN(CC(C)Br)c1ccc2c(c1)Cc1ccccc1-2 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |