1H-Pyrrole-2,5-dione,1-(3,5-dimethylphenyl)- structure
|
Common Name | 1H-Pyrrole-2,5-dione,1-(3,5-dimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 65833-09-2 | Molecular Weight | 201.22100 | |
| Density | 1.235g/cm3 | Boiling Point | 359.7ºC at 760mmHg | |
| Molecular Formula | C12H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.4ºC | |
| Name | 1-(3,5-dimethylphenyl)pyrrole-2,5-dione |
|---|
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760mmHg |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22100 |
| Flash Point | 166.4ºC |
| Exact Mass | 201.07900 |
| PSA | 37.38000 |
| LogP | 1.79780 |
| Index of Refraction | 1.603 |
| InChIKey | PECLZIRCLUPWGS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(N2C(=O)C=CC2=O)c1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |