Benzamide, 4-(1,1-dimethylethyl)-N-(1-methylethyl)- structure
|
Common Name | Benzamide, 4-(1,1-dimethylethyl)-N-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 65861-70-3 | Molecular Weight | 219.32300 | |
| Density | 0.954g/cm3 | Boiling Point | 340.6ºC at 760mmHg | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 4-tert-butyl-N-propan-2-ylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.954g/cm3 |
|---|---|
| Boiling Point | 340.6ºC at 760mmHg |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32300 |
| Flash Point | 205.9ºC |
| Exact Mass | 219.16200 |
| PSA | 29.10000 |
| LogP | 3.51320 |
| Index of Refraction | 1.498 |
| InChIKey | GPHNMBVGSGNQDX-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-tert-butyl-N-(propan-2-yl)benzamide |
| 4-tert-butyl-n-isopropylbenzamide |