1,1-Dimethoxyacetone (7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl)hydrazone structure
|
Common Name | 1,1-Dimethoxyacetone (7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 65867-88-1 | Molecular Weight | 419.30400 | |
| Density | 1.32g/cm3 | Boiling Point | 530.9ºC at 760 mmHg | |
| Molecular Formula | C20H20Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.9ºC | |
| Name | 7-chloro-5-(2-chlorophenyl)-N-[(E)-1,1-dimethoxypropan-2-ylideneamino]-3H-1,4-benzodiazepin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 530.9ºC at 760 mmHg |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.30400 |
| Flash Point | 274.9ºC |
| Exact Mass | 418.09600 |
| PSA | 67.57000 |
| LogP | 3.72090 |
| Index of Refraction | 1.616 |
| InChIKey | WUCKKJHMSZOXLN-BRJLIKDPSA-N |
| SMILES | COC(OC)C(C)=NNC1=Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1 |
|
~%
1,1-Dimethoxyac... CAS#:65867-88-1 |
| Literature: The Upjohn Company Patent: US4086230 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1-Dimethoxyacetone (7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl)hydrazone |
| 1,1-dimethoxy-2-propanone,2-[7-chloro-5-(o-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazone |
| 1,1-dimethoxy-propan-2-one [7-chloro-5-(2-chloro-phenyl)-3H-benzo[e][1,4]diazepin-2-yl]-hydrazone |