5,14-Pentacenedione,1,4-dihydroxy- structure
|
Common Name | 5,14-Pentacenedione,1,4-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 65869-69-4 | Molecular Weight | 340.32800 | |
| Density | 1.518g/cm3 | Boiling Point | 631.7ºC at 760mmHg | |
| Molecular Formula | C22H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.8ºC | |
| Name | 1,4-dihydroxypentacene-5,14-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 631.7ºC at 760mmHg |
| Molecular Formula | C22H12O4 |
| Molecular Weight | 340.32800 |
| Flash Point | 349.8ºC |
| Exact Mass | 340.07400 |
| PSA | 74.60000 |
| LogP | 4.17960 |
| Index of Refraction | 1.826 |
| InChIKey | DATAGEAVWGUSNB-UHFFFAOYSA-N |
| SMILES | O=C1c2cc3cc4ccccc4cc3cc2C(=O)c2c(O)ccc(O)c21 |
|
~%
5,14-Pentacened... CAS#:65869-69-4 |
| Literature: Laduranty, Joelle; Lepage, Lucette; Lepage, Yves Canadian Journal of Chemistry, 1980 , vol. 58, p. 1161 - 1167 |
|
~%
5,14-Pentacened... CAS#:65869-69-4 |
| Literature: Serpaud,B.; Lepage,Y. Bulletin de la Societe Chimique de France, 1977 , p. 539 - 542 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-Dihydroxy-5,14-pentacenchinon |
| dihydroxy-1,4 pentacenequinone-5,14 |