Phosphinic acid,di-2-furanyl- (9CI) structure
|
Common Name | Phosphinic acid,di-2-furanyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 65887-64-1 | Molecular Weight | 198.11300 | |
| Density | 1.43g/cm3 | Boiling Point | 425.2ºC at 760mmHg | |
| Molecular Formula | C8H7O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | bis(furan-2-yl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 425.2ºC at 760mmHg |
| Molecular Formula | C8H7O4P |
| Molecular Weight | 198.11300 |
| Flash Point | 210.9ºC |
| Exact Mass | 198.00800 |
| PSA | 73.39000 |
| LogP | 1.09380 |
| Index of Refraction | 1.558 |
| InChIKey | GKKWPLAHRWSMRB-UHFFFAOYSA-N |
| SMILES | O=P(O)(c1ccco1)c1ccco1 |
|
~%
Phosphinic acid... CAS#:65887-64-1 |
| Literature: Clive; Kang Journal of Organic Chemistry, 2001 , vol. 66, # 18 p. 6083 - 6091 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Di-(2-furyl)-phosphinat |
| BIS(2-FURYL)PHOSPHINIC ACID |
| di-furan-2-yl-phosphinic acid |
| di-2-furanylphosphinic acid |