Soyasapogenol D structure
|
Common Name | Soyasapogenol D | ||
|---|---|---|---|---|
| CAS Number | 65892-76-4 | Molecular Weight | 472.74300 | |
| Density | 1.074g/cm3 | Boiling Point | 545.065°C at 760 mmHg | |
| Molecular Formula | C31H52O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.445°C | |
Use of Soyasapogenol DSoyasapogenol D is a methyl-trimethylsilyl derivative of the sapogenin[1]. |
| Name | 21ξ-methoxy-olean-13(18)-ene-3β,24-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Soyasapogenol D is a methyl-trimethylsilyl derivative of the sapogenin[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Saponin synthesis is induced in response to herbivore insect damage and abiotic stresses and elicited by methyl jasmonate (MJ), a signal component in plant defense responses[1]. |
| References |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 545.065°C at 760 mmHg |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.74300 |
| Flash Point | 283.445°C |
| Exact Mass | 472.39200 |
| PSA | 49.69000 |
| LogP | 6.91030 |
| InChIKey | JAQZKPHHLRTVCY-ZHRKTGFNSA-N |
| SMILES | COC1CC(C)(C)CC2=C3CCC4C5(C)CCC(O)C(C)(CO)C5CCC4(C)C3(C)CCC21C |
| (4aR)-3t-Hydroxy-10ξ-methoxy-4c,6at,6bc,8at,11,11,14bt-heptamethyl-4t-hydroxymethyl-(4arH,14acH)-Δ12a-eicosahydro-picen |
| 21ξ-Methoxy-olean-13(18)-en-3β,24-diol |
| 21ξ-Methoxy-oleanen-(13(18))-diol-(3β,24) |
| Soyasapogenol D |