1,2-bis(ethenyl)benzene,1-(2-ethenylphenyl)-N,N-dimethylmethanamine,1-(2-ethenylphenyl)-N,N-dimethylmethanamine oxide structure
|
Common Name | 1,2-bis(ethenyl)benzene,1-(2-ethenylphenyl)-N,N-dimethylmethanamine,1-(2-ethenylphenyl)-N,N-dimethylmethanamine oxide | ||
|---|---|---|---|---|
| CAS Number | 65899-90-3 | Molecular Weight | 468.67300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H40N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(ethenyl)benzene,1-(2-ethenylphenyl)-N,N-dimethylmethanamine,1-(2-ethenylphenyl)-N,N-dimethylmethanamine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H40N2O |
|---|---|
| Molecular Weight | 468.67300 |
| Exact Mass | 468.31400 |
| PSA | 32.67000 |
| LogP | 7.78850 |
| InChIKey | OCGRBUUFUWNBRE-UHFFFAOYSA-N |
| SMILES | C=Cc1ccccc1C=C.C=Cc1ccccc1CN(C)C.C=Cc1ccccc1C[N+](C)(C)[O-] |
| N,N-dimethyl-1-(2-vinylphenyl)methanamine oxide |
| Benzenemethanamine,ar-ethenyl-N,N-dimethyl-,polymer with diethenylbenzene and ar-ethenyl-N,N-dimethylbenzenemethanamine N-oxide |
| N,N-dimethyl-1-(2-vinylphenyl)methanamine |