Benzenesulfonamide,N-(2-formylphenyl)-4-methyl structure
|
Common Name | Benzenesulfonamide,N-(2-formylphenyl)-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 6590-65-4 | Molecular Weight | 275.32300 | |
| Density | 1.333g/cm3 | Boiling Point | 445.1ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223ºC | |
| Name | N-(2-formylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 445.1ºC at 760 mmHg |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.32300 |
| Flash Point | 223ºC |
| Exact Mass | 275.06200 |
| PSA | 71.62000 |
| LogP | 3.76210 |
| Index of Refraction | 1.63 |
| InChIKey | QLQGABDYGHEFOM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C=O)cc1 |
| HS Code | 2935009090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
| N-sulfonyl 2-aminobenzaldehyde |
| o-tosylaminobenzaldehyde |