benzo[f]quinoline-5,6-dione structure
|
Common Name | benzo[f]quinoline-5,6-dione | ||
|---|---|---|---|---|
| CAS Number | 65938-99-0 | Molecular Weight | 209.20000 | |
| Density | 1.374g/cm3 | Boiling Point | 420.547ºC at 760 mmHg | |
| Molecular Formula | C13H7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.623ºC | |
| Name | benzo[f]quinoline-5,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 420.547ºC at 760 mmHg |
| Molecular Formula | C13H7NO2 |
| Molecular Weight | 209.20000 |
| Flash Point | 209.623ºC |
| Exact Mass | 209.04800 |
| PSA | 47.03000 |
| LogP | 2.12760 |
| Index of Refraction | 1.668 |
| InChIKey | SNNZCIDJKATSPG-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ncccc2-c2ccccc21 |
|
~49%
benzo[f]quinoli... CAS#:65938-99-0 |
| Literature: Braven, J.; Hanson, R. W.; Smith, N. G. Journal of Heterocyclic Chemistry, 1995 , vol. 32, # 3 p. 1051 - 1056 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
|
Name: In vitro inhibitory activity against the cytosolic portion of CD45 protein-tyrosine p...
Source: ChEMBL
Target: Receptor-type tyrosine-protein phosphatase C
External Id: CHEMBL655779
|
|
Name: In vitro inhibition of human T-cell proliferation
Source: ChEMBL
Target: T-cell
External Id: CHEMBL812183
|
|
Name: Cytotoxicity measured against human T-cells
Source: ChEMBL
Target: T-cell
External Id: CHEMBL812180
|
| 4-Azaphenanthren-5,6-dion |
| benzo<f>quinoline-9,10-dione |
| 4-azaphenanthrene-5,6-dione |