N'-(2-aminoethyl)-N'-[(2-ethenylphenyl)methyl]ethane-1,2-diamine,1,2-bis(ethenyl)benzene structure
|
Common Name | N'-(2-aminoethyl)-N'-[(2-ethenylphenyl)methyl]ethane-1,2-diamine,1,2-bis(ethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 65945-33-7 | Molecular Weight | 349.51200 | |
| Density | N/A | Boiling Point | 321.1ºC at 760 mmHg | |
| Molecular Formula | C23H31N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146ºC | |
| Name | N'-(2-aminoethyl)-N'-[(2-ethenylphenyl)methyl]ethane-1,2-diamine,1,2-bis(ethenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 321.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.51200 |
| Flash Point | 146ºC |
| Exact Mass | 349.25200 |
| PSA | 55.28000 |
| LogP | 5.42220 |
| InChIKey | UUZFYSHIFAAYRA-UHFFFAOYSA-N |
| SMILES | C=Cc1ccccc1C=C.C=Cc1ccccc1CN(CCN)CCN |
| N'-(2-aminoethyl)-N'-[(2-ethenylphenyl)methyl]ethane-1,2-diamine |
| 1,2-Ethanediamine,N1-(2-aminoethyl)-N1-((ethenylphenyl)methyl)-,polymer with diethenylbenzene |
| 1,2-Ethanediamine,N-(2-aminoethyl)-N-((ethenylphenyl)methyl)-,polymer with diethenylbenzene |