2-azido-1-(4-methoxyphenyl)ethanone
2-azido-1-(4-methoxyphenyl)ethanone structure
|
Common Name | 2-azido-1-(4-methoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6595-28-4 | Molecular Weight | 191.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Summary: 2-Amino-1-(4-methoxyphenyl)ketone, CAS号 6595-28-4, molecular formula C9H9N3O2, molecular weight 191.18700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-azido-1-(4-methoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9N3O2 |
|---|---|
| Molecular Weight | 191.18700 |
| Exact Mass | 191.06900 |
| PSA | 76.05000 |
| LogP | 1.64096 |
| InChIKey | YUKPOKGKCKZLGT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CN=[N+]=[N-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 10 | |
CAS#:3883-94-1
CAS#:40513-43-7
CAS#:46084-19-9
CAS#:154136-90-0
CAS#:100-09-4
CAS#:33864-03-8
CAS#:35801-73-1![N-[2-Hydroxy-2-(4-methoxyphenyl)ethyl]benzamide structure](https://image.chemsrc.com/caspic/134/15298-28-9.png)
CAS#:15298-28-9![N-[2-(4-methoxyphenyl)-2-oxoethyl]acetamide structure](https://image.chemsrc.com/caspic/320/3755-89-3.png)
CAS#:3755-89-3
CAS#:69163-82-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-azido-1-(4-methoxyphenyl)ethan-1-one |
| 2-azido-1-[4-(methyloxy)phenyl]ethanone |
| 4-methoxyphenacyl azide |
| 4-Methoxy-phenacylazid |
| 2-azido-4'-methoxyacetophenone |
| Ethanone,2-azido-1-(4-methoxyphenyl) |
| 2-AZIDO-1-(4-METHOXY-PHENYL)-ETHANONE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: SMILES notation of 2-azido-1-(4-methoxyphenyl)ethanone is COc1ccc(C(=O)CN=[N+]=[N-])cc1. |
| Q: What are the downstream products of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: Related downstream products(CAS) of 2-azido-1-(4-methoxyphenyl)ethanone: 3883-94-1;40513-43-7;46084-19-9;154136-90-0;100-09-4;33864-03-8;35801-73-1;15298-28-9;3755-89-3;69163-82-2. |
| Q: What is the polar surface area (PSA) of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: Polar surface area (PSA) of 2-azido-1-(4-methoxyphenyl)ethanone is 76.05000. |
| Q: What are the upstream materials of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: Related upstream materials(CAS) of 2-azido-1-(4-methoxyphenyl)ethanone: 2632-13-5;100-06-1;637-69-4;2196-99-8;6832-17-3. |
| Q: What is the CAS number of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: CAS number of 2-azido-1-(4-methoxyphenyl)ethanone is 6595-28-4. |
| Q: What is the molecular weight of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: Molecular weight of 2-azido-1-(4-methoxyphenyl)ethanone is 191.18700. |
| Q: What is the Chinese name of 6595-28-4? |
| A: Chinese name of 6595-28-4 is 6595-28-4. |
| Q: What is the LogP of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: LogP of 2-azido-1-(4-methoxyphenyl)ethanone is 1.64096. |
| Q: What is the InChIKey of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: InChIKey of 2-azido-1-(4-methoxyphenyl)ethanone is YUKPOKGKCKZLGT-UHFFFAOYSA-N. |
| Q: What is the English name of 2-azido-1-(4-methoxyphenyl)ethanone? |
| A: The English name of 2-azido-1-(4-methoxyphenyl)ethanone is 2-azido-1-(4-methoxyphenyl)ethanone. |