2-azido-1-(4-methylphenyl)ethanone
2-azido-1-(4-methylphenyl)ethanone structure
|
Common Name | 2-azido-1-(4-methylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6595-30-8 | Molecular Weight | 175.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Amino-1-(4-methylphenyl)ketone, Chinese name: 2-氨基-1-(4-甲基苯基)酮, CAS number: 6595-30-8, molecular formula: C9H9N3O, molecular weight: 175.18700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-azido-1-(4-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9N3O |
|---|---|
| Molecular Weight | 175.18700 |
| Exact Mass | 175.07500 |
| PSA | 66.82000 |
| LogP | 1.94076 |
| InChIKey | MFBKIKMYVQMIAQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CN=[N+]=[N-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![[2-(4-methylphenyl)-2-oxoethyl] 4-methylbenzenesulfonate structure](https://image.chemsrc.com/caspic/429/98475-04-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 10 | |
CAS#:5467-70-9![Benzenepropanenitrile, a-[[4-(dimethylamino)phenyl]imino]-4-methyl-b-oxo structure](https://image.chemsrc.com/caspic/213/23071-56-9.png)
CAS#:23071-56-9
CAS#:74104-57-7
CAS#:107047-11-0
CAS#:107047-12-1
CAS#:107047-13-2
CAS#:69872-37-3
CAS#:15398-00-2
CAS#:55327-30-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanone,2-azido-1-(4-methylphenyl) |
| 2-azido-4'-methylacetophenone |
| 2-azido-1-(p-tolyl)ethanone |
| 2-azido-1-(4-methylphenyl)ethan-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-azido-1-(4-methylphenyl)ethanone have? |
| A: English synonyms of 2-azido-1-(4-methylphenyl)ethanone: Ethanone,2-azido-1-(4-methylphenyl), 2-azido-4'-methylacetophenone, 2-azido-1-(p-tolyl)ethanone, 2-azido-1-(4-methylphenyl)ethan-1-one. |
| Q: What are the upstream materials of 2-azido-1-(4-methylphenyl)ethanone? |
| A: Related upstream materials(CAS) of 2-azido-1-(4-methylphenyl)ethanone: 619-41-0;122-00-9;622-97-9;17263-64-8;98475-04-8;4209-24-9;335163-16-1. |
| Q: What is the SMILES notation of 2-azido-1-(4-methylphenyl)ethanone? |
| A: SMILES notation of 2-azido-1-(4-methylphenyl)ethanone is Cc1ccc(C(=O)CN=[N+]=[N-])cc1. |
| Q: What is the molecular weight of 2-azido-1-(4-methylphenyl)ethanone? |
| A: Molecular weight of 2-azido-1-(4-methylphenyl)ethanone is 175.18700. |
| Q: What is the InChIKey of 2-azido-1-(4-methylphenyl)ethanone? |
| A: InChIKey of 2-azido-1-(4-methylphenyl)ethanone is MFBKIKMYVQMIAQ-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-azido-1-(4-methylphenyl)ethanone? |
| A: LogP of 2-azido-1-(4-methylphenyl)ethanone is 1.94076. |
| Q: What is the polar surface area (PSA) of 2-azido-1-(4-methylphenyl)ethanone? |
| A: Polar surface area (PSA) of 2-azido-1-(4-methylphenyl)ethanone is 66.82000. |
| Q: What is the molecular formula of 2-azido-1-(4-methylphenyl)ethanone? |
| A: Molecular formula of 2-azido-1-(4-methylphenyl)ethanone is C9H9N3O. |
| Q: What is the CAS number of 2-azido-1-(4-methylphenyl)ethanone? |
| A: CAS number of 2-azido-1-(4-methylphenyl)ethanone is 6595-30-8. |
| Q: What are the downstream products of 2-azido-1-(4-methylphenyl)ethanone? |
| A: Related downstream products(CAS) of 2-azido-1-(4-methylphenyl)ethanone: 5467-70-9;23071-56-9;74104-57-7;107047-11-0;107047-12-1;122-00-9;107047-13-2;69872-37-3;15398-00-2;55327-30-5. |