N,N'-bis(2-pyridylmethyl)pyromellitic diimide
Modify Date: 2026-08-02 16:20:12
N,N'-bis(2-pyridylmethyl)pyromellitic diimide structure
|
Common Name | N,N'-bis(2-pyridylmethyl)pyromellitic diimide | ||
|---|---|---|---|---|
| CAS Number | 659727-22-7 | Molecular Weight | 398.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N'-bis(2-pyridylmethyl)pyromellitic diimide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H14N4O4 |
|---|---|
| Molecular Weight | 398.4 |
| InChIKey | DYRMZFDPYPCWFG-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3c(=O)n(Cc4ccccn4)c(=O)c3cc2c(=O)n1Cc1ccccn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N,N'-bis(2-pyridylmethyl)pyromellitic diimide? |
| A: SMILES notation of N,N'-bis(2-pyridylmethyl)pyromellitic diimide is O=c1c2cc3c(=O)n(Cc4ccccn4)c(=O)c3cc2c(=O)n1Cc1ccccn1. |
| Q: What is the English name of N,N'-bis(2-pyridylmethyl)pyromellitic diimide? |
| A: The English name of N,N'-bis(2-pyridylmethyl)pyromellitic diimide is N,N'-bis(2-pyridylmethyl)pyromellitic diimide. |
| Q: What is the InChIKey of N,N'-bis(2-pyridylmethyl)pyromellitic diimide? |
| A: InChIKey of N,N'-bis(2-pyridylmethyl)pyromellitic diimide is DYRMZFDPYPCWFG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N,N'-bis(2-pyridylmethyl)pyromellitic diimide? |
| A: Molecular weight of N,N'-bis(2-pyridylmethyl)pyromellitic diimide is 398.4. |
| Q: What is the CAS number of N,N'-bis(2-pyridylmethyl)pyromellitic diimide? |
| A: CAS number of N,N'-bis(2-pyridylmethyl)pyromellitic diimide is 659727-22-7. |
| Q: What is the Chinese name of 659727-22-7? |
| A: Chinese name of 659727-22-7 is 659727-22-7. |
| Q: What is the molecular formula of N,N'-bis(2-pyridylmethyl)pyromellitic diimide? |
| A: Molecular formula of N,N'-bis(2-pyridylmethyl)pyromellitic diimide is C22H14N4O4. |