Methyl 3-bromo-2,6-dimethoxybenzoate structure
|
Common Name | Methyl 3-bromo-2,6-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 65977-12-0 | Molecular Weight | 275.096 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 340.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.8±26.5 °C | |
| Name | Methyl 3-bromo-2,6-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.7±37.0 °C at 760 mmHg |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.096 |
| Flash Point | 159.8±26.5 °C |
| Exact Mass | 273.984070 |
| PSA | 44.76000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | IYVSXIFYVRNTDY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(OC)ccc(Br)c1OC |
| HS Code | 2918990090 |
|---|
|
~%
Methyl 3-bromo-... CAS#:65977-12-0 |
| Literature: Doyle,F.P. et al. Journal of the Chemical Society, 1963 , p. 497 - 506 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-Diethoxy-3-bromtetrahydropyran |
| 2H-Pyran,3-bromo-2,6-diethoxytetrahydro |
| Benzoic acid, 3-bromo-2,6-dimethoxy-, methyl ester |
| 3-Brom-2,6-diaethoxy-tetrahydropyran |
| Methyl 3-bromo-2,6-dimethoxybenzoate |
| 3-Brom-2,6-dimethoxy-benzoesaeure-methylester |
| 3-bromo-2,6-diethoxy-tetrahydro-pyran |
| 3-Brom-2,6-diethoxytetrahydropyran |