N-amino-3-bromophenylsuccinimide structure
|
Common Name | N-amino-3-bromophenylsuccinimide | ||
|---|---|---|---|---|
| CAS Number | 66064-11-7 | Molecular Weight | 269.09500 | |
| Density | 1.674g/cm3 | Boiling Point | 399.9ºC at 760 mmHg | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6ºC | |
| Name | 1-amino-3-(3-bromophenyl)pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.674g/cm3 |
|---|---|
| Boiling Point | 399.9ºC at 760 mmHg |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.09500 |
| Flash Point | 195.6ºC |
| Exact Mass | 267.98500 |
| PSA | 63.40000 |
| LogP | 1.80350 |
| Index of Refraction | 1.64 |
| InChIKey | QWNKHWJMJANJRD-UHFFFAOYSA-N |
| SMILES | NN1C(=O)CC(c2cccc(Br)c2)C1=O |
| HS Code | 2925190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-amino-3-(3-bromo-phenyl)-pyrrolidine-2,5-dione |
| N-Amino-3-bromophenylsuccinimide |
| Succinimide,N-amino-2-(m-bromophenyl) |
| 1-Amino-3-(3-bromophenyl)-2,5-pyrrolidinedione |
| IL 16 |
| Aminoimid kwasu 3-bromofenylobursztynowego [Polish] |
| N-Amino-2-(m-bromophenyl)succinimide |