6H-Pyrido(1,2-a)pyrimidin-6-one, 1,2,3,4-tetrahydro-1-methyl-8-phenyl- structure
|
Common Name | 6H-Pyrido(1,2-a)pyrimidin-6-one, 1,2,3,4-tetrahydro-1-methyl-8-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 66066-04-4 | Molecular Weight | 240.30000 | |
| Density | 1.22g/cm3 | Boiling Point | 462.1ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | 1-methyl-8-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 462.1ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 221.6ºC |
| Exact Mass | 240.12600 |
| PSA | 25.24000 |
| LogP | 2.42020 |
| Index of Refraction | 1.648 |
| InChIKey | SSKOIMFORCEUOM-UHFFFAOYSA-N |
| SMILES | CN1CCCn2c1cc(-c1ccccc1)cc2=O |
| HS Code | 2933990090 |
|---|
|
~%
6H-Pyrido(1,2-a... CAS#:66066-04-4 |
| Literature: Yamanouchi Pharmaceutical Co., Ltd. Patent: US4288438 A1, 1981 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-8-phenyl-1,2,3,4-tetrahydro-pyrido[1,2-a]pyrimidin-6-one |
| 1,2,3,4-Tetrahydro-1-methyl-8-phenyl-6H-pyrido(1,2-a)pyrimidin-6-one |
| 1-methyl-6-oxo-8-phenyl-1,2,3,4,6-pentahydropyrido [1,2-a] pyrimidine |
| 6H-Pyrido(1,2-a)pyrimidin-6-one,1,2,3,4-tetrahydro-1-methyl-8-phenyl |
| 1-Methyl-6-oxo-8-phenyl-1,2,3,4-tetrahydro-6H-pyrido-<1,2-a>pyridin |