3,4-Dimethoxybenzoic acid 3-methyl-2-butenyl ester structure
|
Common Name | 3,4-Dimethoxybenzoic acid 3-methyl-2-butenyl ester | ||
|---|---|---|---|---|
| CAS Number | 66067-30-9 | Molecular Weight | 250.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methylbut-2-enyl 3,4-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.29000 |
| Exact Mass | 250.12100 |
| PSA | 44.76000 |
| LogP | 2.82680 |
| InChIKey | NWJHMOYAEKIJSU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OCC=C(C)C)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,3,4-dimethoxy-,3-methyl-2-butenyl ester |
| 3,4-Dimethoxybenzoic acid 3-methyl-2-butenyl ester |