[2R-(2α,3Z,5α)]-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with tert-butylamine (1:1) structure
|
Common Name | [2R-(2α,3Z,5α)]-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with tert-butylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 66069-34-9 | Molecular Weight | 272.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | clavulanic acid tert-butylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20N2O5 |
|---|---|
| Molecular Weight | 272.29800 |
| Exact Mass | 272.13700 |
| PSA | 113.09000 |
| LogP | 0.28620 |
| InChIKey | ODDOAHLLFSACIM-JSYANWSFSA-N |
| SMILES | CC(C)(C)N.O=C(O)C1C(=CCO)OC2CC(=O)N21 |
| (2R-(2α,3Z,5α))-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with tert-butylamine (1:1) |
| t-butylammonium clavulanate |
| (2R,5R)-3-[2-Hydroxy-eth-(Z)-ylidene]-7-oxo-4-oxa-1-aza-bicyclo[3.2.0]heptane-2-carboxylic acid |
| compound with tert-butylamine |