2,8-Dimethyldibenzo[c,g][1,2,5,6]tetrathiocine structure
|
Common Name | 2,8-Dimethyldibenzo[c,g][1,2,5,6]tetrathiocine | ||
|---|---|---|---|---|
| CAS Number | 66086-39-3 | Molecular Weight | 308.50500 | |
| Density | 1.329g/cm3 | Boiling Point | 403.9ºC at 760 mmHg | |
| Molecular Formula | C14H12S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 2,8-dimethylbenzo[c][1,2,5,6]benzotetrathiocine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760 mmHg |
| Molecular Formula | C14H12S4 |
| Molecular Weight | 308.50500 |
| Flash Point | 199.4ºC |
| Exact Mass | 307.98200 |
| PSA | 101.20000 |
| LogP | 6.21560 |
| Index of Refraction | 1.718 |
| InChIKey | VSTYQQKTLXKBME-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)SSc1ccc(C)cc1SS2 |
|
~%
2,8-Dimethyldib... CAS#:66086-39-3 |
| Literature: Houk,J.; Whitesides,G.M. Journal of the American Chemical Society, 1987 , vol. 109, p. 6825 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,8-Dimethyldibenzo<c.g><1.2.5.6>tetrathia-cyclooctadien |
| Dimethyldibenzo-(1,2,5,6)-tetrathiocin |
| 2,8-Dimethyldibenzo(c,g)(1,2,5,6)tetrathiocine |
| 2,8-dimethyldibenzo<c,g>tetrathiocin |
| dimer of 3,4-dithio-toluene |