2,5-Cyclohexadiene-1,4-dione,2-methoxy-5-[(4-methoxyphenyl)-4-morpholinylmethyl]- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2-methoxy-5-[(4-methoxyphenyl)-4-morpholinylmethyl]- | ||
|---|---|---|---|---|
| CAS Number | 66092-36-2 | Molecular Weight | 343.37400 | |
| Density | 1.26g/cm3 | Boiling Point | 496.6ºC at 760mmHg | |
| Molecular Formula | C19H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1ºC | |
| Name | 2-methoxy-5-[(4-methoxyphenyl)-morpholin-4-ylmethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 496.6ºC at 760mmHg |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.37400 |
| Flash Point | 254.1ºC |
| Exact Mass | 343.14200 |
| PSA | 65.07000 |
| LogP | 1.61490 |
| Index of Refraction | 1.591 |
| InChIKey | NKYQAGJQXBIOPN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)C(C(c2ccc(OC)cc2)N2CCOCC2)=CC1=O |
|
~%
2,5-Cyclohexadi... CAS#:66092-36-2 |
| Literature: Jurd,L. Australian Journal of Chemistry, 1978 , vol. 31, p. 347 - 352 |
|
~%
2,5-Cyclohexadi... CAS#:66092-36-2 |
| Literature: Jurd,L. Australian Journal of Chemistry, 1978 , vol. 31, p. 347 - 352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methoxy-5-[(4-methoxy-phenyl)-morpholin-4-yl-methyl]-[1,4]benzoquinone |