Talmetoprim
Modify Date: 2026-07-09 18:56:10
Talmetoprim structure
|
Common Name | Talmetoprim | ||
|---|---|---|---|---|
| CAS Number | 66093-35-4 | Molecular Weight | 420.41800 | |
| Density | 1.369g/cm3 | Boiling Point | 692.6ºC at 760 mmHg | |
| Molecular Formula | C22H20N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.7ºC | |
| Name | Talmetoprim |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 692.6ºC at 760 mmHg |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.41800 |
| Flash Point | 372.7ºC |
| Exact Mass | 420.14300 |
| PSA | 116.87000 |
| LogP | 3.12220 |
| Index of Refraction | 1.649 |
| InChIKey | MGBWNIUCAVQUCE-UHFFFAOYSA-N |
| SMILES | COc1cc(Cc2cnc(N3C(=O)c4ccccc4C3=O)nc2N)cc(OC)c1OC |
| HS Code | 2933599090 |
|---|
|
~%
Talmetoprim CAS#:66093-35-4 |
| Literature: BASF Aktiengesellschaft Patent: US4189581 A1, 1980 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phthalimido-4-amino-5-(3,4,5-trimethoxybenzyl)-pyrimidine |
| N-[4-Amino-5-(3,4,5-trimethoxybenzyl)-2-pyrimidinyl]phthalimide |
| N-[4-amino-5-(3,4,5-trimethoxy-benzyl)-pyrimidin-2-yl]-phthalimide |