1-[(3S,5S,8R,9S,10S,13R,14S,17S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone structure
|
Common Name | 1-[(3S,5S,8R,9S,10S,13R,14S,17S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 6610-85-1 | Molecular Weight | 360.57300 | |
| Density | 1.014g/cm3 | Boiling Point | 445.9ºC at 760 mmHg | |
| Molecular Formula | C24H40O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | (3beta,5alpha)-3-hydroxy-4,4,14-trimethylpregnan-20-one |
|---|
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 445.9ºC at 760 mmHg |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.57300 |
| Flash Point | 190ºC |
| Exact Mass | 360.30300 |
| PSA | 37.30000 |
| LogP | 5.62140 |
| Index of Refraction | 1.51 |
| InChIKey | UTEMWPYTGYCZAE-GARFPQAWSA-N |
| SMILES | CC(=O)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C3CCC12C |
|
~%
1-[(3S,5S,8R,9S... CAS#:6610-85-1 |
| Literature: Barnes Australian Journal of Chemistry, 1956 , vol. 9, p. 228,231 |
|
~%
1-[(3S,5S,8R,9S... CAS#:6610-85-1 |
| Literature: Pettit,G.R. Tetrahedron, 1963 , vol. 19, p. 1143 - 1152 |
|
~%
1-[(3S,5S,8R,9S... CAS#:6610-85-1 |
| Literature: Pettit,G.R. Tetrahedron, 1963 , vol. 19, p. 1143 - 1152 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |