N,N-bis(2-chloroethyl)-2-[(2,2-dichloroacetyl)amino]-4-methylsulfanyl-butanamide structure
|
Common Name | N,N-bis(2-chloroethyl)-2-[(2,2-dichloroacetyl)amino]-4-methylsulfanyl-butanamide | ||
|---|---|---|---|---|
| CAS Number | 6611-53-6 | Molecular Weight | 384.15000 | |
| Density | 1.368g/cm3 | Boiling Point | 549.1ºC at 760 mmHg | |
| Molecular Formula | C11H18Cl4N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9ºC | |
| Name | N,N-bis(2-chloroethyl)-2-(2,2-dichloroacetamido)-4-(methylthio)butanamide |
|---|
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 549.1ºC at 760 mmHg |
| Molecular Formula | C11H18Cl4N2O2S |
| Molecular Weight | 384.15000 |
| Flash Point | 285.9ºC |
| Exact Mass | 381.98400 |
| PSA | 74.71000 |
| LogP | 2.72510 |
| Index of Refraction | 1.537 |
| InChIKey | FQMYQUPQCYFUFP-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(Cl)Cl)C(=O)N(CCCl)CCCl |
|
~%
N,N-bis(2-chlor... CAS#:6611-53-6 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |