perfluoroperhydrofluoranthene structure
|
Common Name | perfluoroperhydrofluoranthene | ||
|---|---|---|---|---|
| CAS Number | 662-28-2 | Molecular Weight | 686.13000 | |
| Density | 1.94g/cm3 | Boiling Point | 244.9ºC at 760 mmHg | |
| Molecular Formula | C16F26 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.8ºC | |
| Name | 1,1,2,2,3,3,3a,4,4,5,5,6,6,6a,6b,7,7,8,8,9,9,10,10,10a,10b,10c-hexacosafluorofluoranthene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 244.9ºC at 760 mmHg |
| Molecular Formula | C16F26 |
| Molecular Weight | 686.13000 |
| Flash Point | 98.8ºC |
| Exact Mass | 685.95800 |
| LogP | 7.64360 |
| Index of Refraction | 1.326 |
| InChIKey | YEMLBKSPDFVXEO-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(C1(F)F)C1(F)C(F)(F)C(F)(F)C(F)(F)C3(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C31F |
| HS Code | 2932999099 |
|---|
|
~%
perfluoroperhyd... CAS#:662-28-2 |
| Literature: Burdon, James; Gill, Harpal S.; Parsons, Ian W.; Tatlow, John Colin Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1726 - 1730 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hexacosafluoro-hexadecahydro-fluoranthene |
| Pfphfa |
| Fluoranthene,hexacosafluorohexadecahydro-(9CI) |
| Flutec PP 24 |
| Hexacosafluor-hexadecahydro-fluoranthen |
| Fluoranthene,hexacosafluorohexadecahydro |
| perfluoroperhydrofluoranthene |
| Perfluoroperhydrofluoranthrene |