1,1,2,2,3,3,3-heptafluoropropyl thiohypochlorite structure
|
Common Name | 1,1,2,2,3,3,3-heptafluoropropyl thiohypochlorite | ||
|---|---|---|---|---|
| CAS Number | 662-42-0 | Molecular Weight | 236.53900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3ClF7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3,3-heptafluoropropyl thiohypochlorite |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3ClF7S |
|---|---|
| Molecular Weight | 236.53900 |
| Exact Mass | 235.93000 |
| PSA | 25.30000 |
| LogP | 3.66380 |
| InChIKey | MBFIFWXOAXJGBJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)SCl |
|
~%
1,1,2,2,3,3,3-h... CAS#:662-42-0 |
| Literature: Kober Journal of the American Chemical Society, 1959 , vol. 81, p. 4810 |
|
~%
1,1,2,2,3,3,3-h... CAS#:662-42-0 |
| Literature: De Marco; Shreeve Inorganic Chemistry, 1973 , vol. 12, p. 1896 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| heptafluoro-propane-1-sulphenic acid chloride |
| Heptafluor-1-propansulfenylchlorid |
| Heptafluor-propan-1-sulfenylchlorid |
| heptafluoro-1-propanesulfenyl chloride |
| Heptafluor-propan-1-sulfensaeurechlorid |
| thiohypochlorous acid 1,1,2,2,3,3,3-heptafluoro-propyl ester |
| heptafluoro-propane-1-sulfenyl chloride |
| 1-Propanesulfenyl chloride,1,1,2,2,3,3,3-heptafluoro |
| 1,1,2,2,3,3,3-heptafluoro-1-propanesulfenyl chloride |