2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid
Modify Date: 2025-08-22 11:31:21
2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid structure
|
Common Name | 2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 662154-26-9 | Molecular Weight | 269.20800 | |
| Density | 1.424g/cm3 | Boiling Point | 486.5ºC at 760 mmHg | |
| Molecular Formula | C11H11NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248ºC | |
| Name | 2-(2-formyl-6-methoxy-4-nitrophenoxy)propanoic acid |
|---|
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 486.5ºC at 760 mmHg |
| Molecular Formula | C11H11NO7 |
| Molecular Weight | 269.20800 |
| Flash Point | 248ºC |
| Exact Mass | 269.05400 |
| PSA | 118.65000 |
| LogP | 1.79100 |
| Index of Refraction | 1.589 |
| InChIKey | MIQCEOGOTBKVCB-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])cc(C=O)c1OC(C)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |