Butanoic acid,4-oxo-4-[(triphenylmethyl)amino]
![Butanoic acid,4-oxo-4-[(triphenylmethyl)amino] Structure](https://image.chemsrc.com/caspic/429/6622-12-4.png)
Butanoic acid,4-oxo-4-[(triphenylmethyl)amino] structure
|
Common Name | Butanoic acid,4-oxo-4-[(triphenylmethyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 6622-12-4 | Molecular Weight | 359.41800 | |
| Density | 1.2g/cm3 | Boiling Point | 622.3ºC at 760 mmHg | |
| Molecular Formula | C23H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-oxo-4-(tritylamino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 622.3ºC at 760 mmHg |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.41800 |
| Flash Point | 330.2ºC |
| Exact Mass | 359.15200 |
| PSA | 66.40000 |
| LogP | 4.35040 |
| Index of Refraction | 1.606 |
| InChIKey | CAEZYMRXMHXIFU-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Butanoic acid,4... CAS#:6622-12-4 |
| Literature: Schreiber,K.C.; Fernandez,V.P. Journal of Organic Chemistry, 1961 , vol. 26, p. 1744 - 1747 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:6622-13-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Triphenylmethyl-bernsteinsaeure-monoamid |
| N-Trityl-bernsteinsaeure-monoamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 6622-12-4? |
| A: Chinese name of 6622-12-4 is 6622-12-4. |
| Q: What is the InChIKey of 4-oxo-4-(tritylamino)butanoic acid? |
| A: InChIKey of 4-oxo-4-(tritylamino)butanoic acid is CAEZYMRXMHXIFU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-oxo-4-(tritylamino)butanoic acid? |
| A: Molecular formula of 4-oxo-4-(tritylamino)butanoic acid is C23H21NO3. |
| Q: What is the boiling point of 4-oxo-4-(tritylamino)butanoic acid? |
| A: Boiling point of 4-oxo-4-(tritylamino)butanoic acid is 622.3ºC at 760 mmHg. |
| Q: What are the downstream products of 4-oxo-4-(tritylamino)butanoic acid? |
| A: Related downstream products(CAS) of 4-oxo-4-(tritylamino)butanoic acid: 6622-13-5. |
| Q: What is the molecular weight of 4-oxo-4-(tritylamino)butanoic acid? |
| A: Molecular weight of 4-oxo-4-(tritylamino)butanoic acid is 359.41800. |
| Q: What is the SMILES notation of 4-oxo-4-(tritylamino)butanoic acid? |
| A: SMILES notation of 4-oxo-4-(tritylamino)butanoic acid is O=C(O)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the LogP of 4-oxo-4-(tritylamino)butanoic acid? |
| A: LogP of 4-oxo-4-(tritylamino)butanoic acid is 4.35040. |
| Q: What is the CAS number of 4-oxo-4-(tritylamino)butanoic acid? |
| A: CAS number of 4-oxo-4-(tritylamino)butanoic acid is 6622-12-4. |
| Q: What is the English name of 4-oxo-4-(tritylamino)butanoic acid? |
| A: The English name of 4-oxo-4-(tritylamino)butanoic acid is 4-oxo-4-(tritylamino)butanoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |