propan-2-yl N-(2,4-dimethylphenyl)carbamate structure
|
Common Name | propan-2-yl N-(2,4-dimethylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 6622-37-3 | Molecular Weight | 207.26900 | |
| Density | 1.063g/cm3 | Boiling Point | 255.6ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.4ºC | |
| Name | isopropyl (2,4-dimethylphenyl)carbamate |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 255.6ºC at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Flash Point | 108.4ºC |
| Exact Mass | 207.12600 |
| PSA | 38.33000 |
| LogP | 3.33330 |
| Index of Refraction | 1.54 |
| InChIKey | BMXCXCVYHRXVQI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)OC(C)C)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |