3-(4-methyl-1-piperidyl)-1-phenyl-propan-1-one structure
|
Common Name | 3-(4-methyl-1-piperidyl)-1-phenyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6622-90-8 | Molecular Weight | 231.33300 | |
| Density | 1.001g/cm3 | Boiling Point | 352.7ºC at 760 mmHg | |
| Molecular Formula | C15H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.3ºC | |
| Name | 3-(4-methylpiperidin-1-yl)-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.001g/cm3 |
|---|---|
| Boiling Point | 352.7ºC at 760 mmHg |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.33300 |
| Flash Point | 126.3ºC |
| Exact Mass | 231.16200 |
| PSA | 20.31000 |
| LogP | 2.92920 |
| Index of Refraction | 1.52 |
| InChIKey | LVTXFVGIXHOMSX-UHFFFAOYSA-N |
| SMILES | CC1CCN(CCC(=O)c2ccccc2)CC1 |
|
~%
3-(4-methyl-1-p... CAS#:6622-90-8 |
| Literature: Huang; Hall European Journal of Medicinal Chemistry, 1996 , vol. 31, # 4 p. 281 - 290 |
|
~%
3-(4-methyl-1-p... CAS#:6622-90-8 |
| Literature: Okimoto, Mitsuhiro; Ohashi, Kousuke; Yamamori, Haruki; Nishikawa, Shinnosuke; Hoshi, Masayuki; Yoshida, Takashi Synthesis, 2012 , vol. 44, # 9 p. 1315 - 1322 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(4-methyl-piperidin-1-yl)-1-phenyl-propan-1-one |